C37H56O6Si2 — CID 11411202
3-[2-(2-hydroxyethyl)-4,5-dimethoxyphenyl]-6-phenylmethoxy-2-trimethylsilyl-4-[2-tri(propan-2-yl)silyloxyethyl]phenol (PubChem CID 11411202) has the molecular formula C37H56O6Si2 and a molecular weight of 653.02 g/mol. Its IUPAC name is 3-[2-(2-hydroxyethyl)-4,5-dimethoxyphenyl]-6-phenylmethoxy-2-trimethylsilyl-4-[2-tri(propan-2-yl)silyloxyethyl]phenol.
| Compound Name | 3-[2-(2-hydroxyethyl)-4,5-dimethoxyphenyl]-6-phenylmethoxy-2-trimethylsilyl-4-[2-tri(propan-2-yl)silyloxyethyl]phenol |
|---|---|
| PubChem CID | 11411202 |
| Molecular Formula | C37H56O6Si2 |
| Molecular Weight | 653.02 g/mol |
| Exact Mass | 652.36 |
| IUPAC Name | 3-[2-(2-hydroxyethyl)-4,5-dimethoxyphenyl]-6-phenylmethoxy-2-trimethylsilyl-4-[2-tri(propan-2-yl)silyloxyethyl]phenol |
| SMILES | COc1cc(CCO)c(-c2c(CCO[Si](C(C)C)(C(C)C)C(C)C)cc(OCc3ccccc3)c(O)c2[Si](C)(C)C)cc1OC |
| InChI | InChI=1S/C37H56O6Si2/c1-25(2)45(26(3)4,27(5)6)43-20-18-30-22-34(42-24-28-15-13-12-14-16-28)36(39)37(44(9,10)11)35(30)31-23-33(41-8)32(40-7)21-29(31)17-19-38/h12-16,21-23,25-27,38-39H,17-20,24H2,1-11H3 |
| InChIKey | CCGHKBURBUDLSR-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.02 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|