C16H21FN4S — CID 111940767
1-[[4-(dimethylamino)-3-fluorophenyl]methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine (PubChem CID 111940767) has the molecular formula C16H21FN4S and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)-3-fluorophenyl]methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 1-[[4-(dimethylamino)-3-fluorophenyl]methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111940767 |
| Molecular Formula | C16H21FN4S |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-[[4-(dimethylamino)-3-fluorophenyl]methyl]-2-methyl-3-(thiophen-3-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1ccsc1)NCc1ccc(N(C)C)c(F)c1 |
| InChI | InChI=1S/C16H21FN4S/c1-18-16(20-10-13-6-7-22-11-13)19-9-12-4-5-15(21(2)3)14(17)8-12/h4-8,11H,9-10H2,1-3H3,(H2,18,19,20) |
| InChIKey | FSFMNAZGSSZXFU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|