C11H12O3 — CID 11194850
(3aS,9aS)-1,3a,4,5,8,9-hexahydrocyclopenta[d][2]benzofuran-3,7-dione (PubChem CID 11194850) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is (3aS,9aS)-1,3a,4,5,8,9-hexahydrocyclopenta[d][2]benzofuran-3,7-dione.
| Compound Name | (3aS,9aS)-1,3a,4,5,8,9-hexahydrocyclopenta[d][2]benzofuran-3,7-dione |
|---|---|
| PubChem CID | 11194850 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (3aS,9aS)-1,3a,4,5,8,9-hexahydrocyclopenta[d][2]benzofuran-3,7-dione |
| SMILES | O=C1CC[C@]23COC(=O)[C@H]2CCC=C13 |
| InChI | InChI=1S/C11H12O3/c12-9-4-5-11-6-14-10(13)8(11)3-1-2-7(9)11/h2,8H,1,3-6H2/t8-,11-/m1/s1 |
| InChIKey | ZZNGUUVCAPPIAH-LDYMZIIASA-N |
| XLogP | 1.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |