C8H10O3 — CID 18648431
(1S,5R,7R)-3,10-dioxatricyclo[5.2.1.01,5]decan-4-one (PubChem CID 18648431) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is (1S,5R,7R)-3,10-dioxatricyclo[5.2.1.01,5]decan-4-one.
| Compound Name | (1S,5R,7R)-3,10-dioxatricyclo[5.2.1.01,5]decan-4-one |
|---|---|
| PubChem CID | 18648431 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (1S,5R,7R)-3,10-dioxatricyclo[5.2.1.01,5]decan-4-one |
| SMILES | O=C1OC[C@]23CC[C@H](C[C@@H]12)O3 |
| InChI | InChI=1S/C8H10O3/c9-7-6-3-5-1-2-8(6,11-5)4-10-7/h5-6H,1-4H2/t5-,6+,8-/m1/s1 |
| InChIKey | FAOBRYMLFHGWIL-GKROBHDKSA-N |
| XLogP | 0.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |