C21H25N7 — CID 111973990
2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine (PubChem CID 111973990) has the molecular formula C21H25N7 and a molecular weight of 375.48 g/mol. Its IUPAC name is 2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine.
| Compound Name | 2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111973990 |
| Molecular Formula | C21H25N7 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 2-methyl-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(C)ccc12)NCCc1nnc2ccccn12 |
| InChI | InChI=1S/C21H25N7/c1-15-6-7-17-16(14-25-18(17)13-15)8-10-23-21(22-2)24-11-9-20-27-26-19-5-3-4-12-28(19)20/h3-7,12-14,25H,8-11H2,1-2H3,(H2,22,23,24) |
| InChIKey | RKLIVLAXNOIXEM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|