C20H20N2O2 — CID 11198002
(4bR,8aS,10aR)-4b,8,8,10a-tetramethyl-3,7-dioxo-9,10-dihydro-8aH-phenanthrene-2,6-dicarbonitrile (PubChem CID 11198002) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is (4bR,8aS,10aR)-4b,8,8,10a-tetramethyl-3,7-dioxo-9,10-dihydro-8aH-phenanthrene-2,6-dicarbonitrile.
| Compound Name | (4bR,8aS,10aR)-4b,8,8,10a-tetramethyl-3,7-dioxo-9,10-dihydro-8aH-phenanthrene-2,6-dicarbonitrile |
|---|---|
| PubChem CID | 11198002 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (4bR,8aS,10aR)-4b,8,8,10a-tetramethyl-3,7-dioxo-9,10-dihydro-8aH-phenanthrene-2,6-dicarbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=C[C@@]2(C)C3=CC(=O)C(C#N)=C[C@@]3(C)CC[C@H]12 |
| InChI | InChI=1S/C20H20N2O2/c1-18(2)15-5-6-19(3)8-12(10-21)14(23)7-16(19)20(15,4)9-13(11-22)17(18)24/h7-9,15H,5-6H2,1-4H3/t15-,19-,20-/m1/s1 |
| InChIKey | BQDNSKXHOWSOHH-CDHQVMDDSA-N |
| XLogP | 3.43 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |