C22H27ClIN5O3 — CID 111982066
1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[2-(2-methoxyphenoxy)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111982066) has the molecular formula C22H27ClIN5O3 and a molecular weight of 571.85 g/mol. Its IUPAC name is 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[2-(2-methoxyphenoxy)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[2-(2-methoxyphenoxy)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111982066 |
| Molecular Formula | C22H27ClIN5O3 |
| Molecular Weight | 571.85 g/mol |
| Exact Mass | 571.08 |
| IUPAC Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-[2-(2-methoxyphenoxy)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1nc(-c2ccc(Cl)cc2)no1)NCC(C)Oc1ccccc1OC.I |
| InChI | InChI=1S/C22H26ClN5O3.HI/c1-15(30-19-7-5-4-6-18(19)29-3)14-26-22(24-2)25-13-12-20-27-21(28-31-20)16-8-10-17(23)11-9-16;/h4-11,15H,12-14H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | WTERNXJFHRLMPK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.85 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|