C15H13F4N3O3 — CID 11199164
ethyl (E)-3-[(E)-[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate (PubChem CID 11199164) has the molecular formula C15H13F4N3O3 and a molecular weight of 359.28 g/mol. Its IUPAC name is ethyl (E)-3-[(E)-[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate.
| Compound Name | ethyl (E)-3-[(E)-[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate |
|---|---|
| PubChem CID | 11199164 |
| Molecular Formula | C15H13F4N3O3 |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | ethyl (E)-3-[(E)-[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate |
| SMILES | CCOC(=O)/C=C(\C=N\Nc1cc(OC)c(C#N)cc1F)C(F)(F)F |
| InChI | InChI=1S/C15H13F4N3O3/c1-3-25-14(23)5-10(15(17,18)19)8-21-22-12-6-13(24-2)9(7-20)4-11(12)16/h4-6,8,22H,3H2,1-2H3/b10-5+,21-8+ |
| InChIKey | JGJJCVDNQJHRMR-KGQIKMFISA-N |
| XLogP | 3.16 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|