C10H9N3O3 — CID 66682645
2-[(4-cyano-3-methoxyphenyl)hydrazinylidene]acetic acid (PubChem CID 66682645) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is 2-[(4-cyano-3-methoxyphenyl)hydrazinylidene]acetic acid.
| Compound Name | 2-[(4-cyano-3-methoxyphenyl)hydrazinylidene]acetic acid |
|---|---|
| PubChem CID | 66682645 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 2-[(4-cyano-3-methoxyphenyl)hydrazinylidene]acetic acid |
| SMILES | COc1cc(NN=CC(=O)O)ccc1C#N |
| InChI | InChI=1S/C10H9N3O3/c1-16-9-4-8(3-2-7(9)5-11)13-12-6-10(14)15/h2-4,6,13H,1H3,(H,14,15) |
| InChIKey | QSVXJLBZTAQLDU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 94.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|