C23H44N6O2 — CID 111993683
tert-butyl N-[1-[N'-methyl-N-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate (PubChem CID 111993683) has the molecular formula C23H44N6O2 and a molecular weight of 436.65 g/mol. Its IUPAC name is tert-butyl N-[1-[N'-methyl-N-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[N'-methyl-N-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 111993683 |
| Molecular Formula | C23H44N6O2 |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.35 |
| IUPAC Name | tert-butyl N-[1-[N'-methyl-N-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]carbamimidoyl]pyrrolidin-3-yl]carbamate |
| SMILES | C/N=C(/NCC1(N2CCCCC2)CCN(C)CC1)N1CCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H44N6O2/c1-22(2,3)31-21(30)26-19-9-14-28(17-19)20(24-4)25-18-23(10-15-27(5)16-11-23)29-12-7-6-8-13-29/h19H,6-18H2,1-5H3,(H,24,25)(H,26,30) |
| InChIKey | NAVKHVFGYXLONC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|