C17H38IN5O2S — CID 111996352
3-(diethylaminomethyl)-N-[2-(diethylsulfamoyl)ethyl]-N'-methylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111996352) has the molecular formula C17H38IN5O2S and a molecular weight of 503.50 g/mol. Its IUPAC name is 3-(diethylaminomethyl)-N-[2-(diethylsulfamoyl)ethyl]-N'-methylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | 3-(diethylaminomethyl)-N-[2-(diethylsulfamoyl)ethyl]-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111996352 |
| Molecular Formula | C17H38IN5O2S |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 3-(diethylaminomethyl)-N-[2-(diethylsulfamoyl)ethyl]-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN(CC)CC1CCN(/C(=N/C)NCCS(=O)(=O)N(CC)CC)C1.I |
| InChI | InChI=1S/C17H37N5O2S.HI/c1-6-20(7-2)14-16-10-12-21(15-16)17(18-5)19-11-13-25(23,24)22(8-3)9-4;/h16H,6-15H2,1-5H3,(H,18,19);1H |
| InChIKey | YWKWGBJWIXJLQN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|