C16H11Cl2NO4S2 — CID 11200858
3-(benzenesulfonyl)-4-(3,4-dichlorophenyl)sulfonyl-1H-pyrrole (PubChem CID 11200858) has the molecular formula C16H11Cl2NO4S2 and a molecular weight of 416.31 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-4-(3,4-dichlorophenyl)sulfonyl-1H-pyrrole.
| Compound Name | 3-(benzenesulfonyl)-4-(3,4-dichlorophenyl)sulfonyl-1H-pyrrole |
|---|---|
| PubChem CID | 11200858 |
| Molecular Formula | C16H11Cl2NO4S2 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 414.95 |
| IUPAC Name | 3-(benzenesulfonyl)-4-(3,4-dichlorophenyl)sulfonyl-1H-pyrrole |
| SMILES | O=S(=O)(c1ccccc1)c1c[nH]cc1S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H11Cl2NO4S2/c17-13-7-6-12(8-14(13)18)25(22,23)16-10-19-9-15(16)24(20,21)11-4-2-1-3-5-11/h1-10,19H |
| InChIKey | NAFNEBTUSWYWEA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |