C23H27NO5S — CID 11201225
[3-[[(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethyl]carbamoyl]-2-methylphenyl] acetate (PubChem CID 11201225) has the molecular formula C23H27NO5S and a molecular weight of 429.54 g/mol. Its IUPAC name is [3-[[(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethyl]carbamoyl]-2-methylphenyl] acetate.
| Compound Name | [3-[[(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethyl]carbamoyl]-2-methylphenyl] acetate |
|---|---|
| PubChem CID | 11201225 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | [3-[[(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylsulfanylethyl]carbamoyl]-2-methylphenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)N[C@@H](CSc2ccccc2)[C@H]2COC(C)(C)O2)c1C |
| InChI | InChI=1S/C23H27NO5S/c1-15-18(11-8-12-20(15)28-16(2)25)22(26)24-19(21-13-27-23(3,4)29-21)14-30-17-9-6-5-7-10-17/h5-12,19,21H,13-14H2,1-4H3,(H,24,26)/t19-,21+/m0/s1 |
| InChIKey | RGVCPFUQVWSVFH-PZJWPPBQSA-N |
| XLogP | 3.96 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|