C27H42N5O+ — CID 11201802
7-[(E)-5-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-enyl]-N-methoxy-9-methylpurin-9-ium-6-amine (PubChem CID 11201802) has the molecular formula C27H42N5O+ and a molecular weight of 452.67 g/mol. Its IUPAC name is 7-[(E)-5-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-enyl]-N-methoxy-9-methylpurin-9-ium-6-amine.
| Compound Name | 7-[(E)-5-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-enyl]-N-methoxy-9-methylpurin-9-ium-6-amine |
|---|---|
| PubChem CID | 11201802 |
| Molecular Formula | C27H42N5O+ |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.34 |
| IUPAC Name | 7-[(E)-5-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-3-methylpent-2-enyl]-N-methoxy-9-methylpurin-9-ium-6-amine |
| SMILES | C=C1CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1CC/C(C)=C/Cn1c[n+](C)c2ncnc(NOC)c21 |
| InChI | InChI=1S/C27H42N5O/c1-19(13-16-32-18-31(6)25-23(32)24(30-33-7)28-17-29-25)9-11-21-20(2)10-12-22-26(3,4)14-8-15-27(21,22)5/h13,17-18,21-22H,2,8-12,14-16H2,1,3-7H3,(H,28,29,30)/q+1/b19-13+/t21-,22-,27+/m0/s1 |
| InChIKey | YFDGRALOPVQFEO-MZBNONOLSA-N |
| XLogP | 5.75 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|