ethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate

C15H30O3Si — CID 11208427

IUPACethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate
SMILESC=C(C)C(CCC(C)CC(=O)OCC)O[Si](C)(C)C
InChIInChI=1S/C15H30O3Si/c1-8-17-15(16)11-13(4)9-10-14(12(2)3)18-19(5,6)7/h13-14H,2,8-11H2,1,3-7H3
InChIKeyIXGQDLWVUVOUNN-UHFFFAOYSA-N
MW286.49 g/mol
LogP4.15
Rot. Bonds9

About ethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate

ethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate (PubChem CID 11208427) has the molecular formula C15H30O3Si and a molecular weight of 286.49 g/mol. Its IUPAC name is ethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate.

Molecular Properties

Compound Nameethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate
PubChem CID11208427
Molecular FormulaC15H30O3Si
Molecular Weight286.49 g/mol
Exact Mass286.20
IUPAC Nameethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate
SMILESC=C(C)C(CCC(C)CC(=O)OCC)O[Si](C)(C)C
InChIInChI=1S/C15H30O3Si/c1-8-17-15(16)11-13(4)9-10-14(12(2)3)18-19(5,6)7/h13-14H,2,8-11H2,1,3-7H3
InChIKeyIXGQDLWVUVOUNN-UHFFFAOYSA-N
XLogP4.15
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.49
LogP ≤ 54.15
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze ethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate?
The IUPAC name of ethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate (CID 11208427) is ethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate.
What is the SMILES notation for ethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate?
The canonical SMILES for ethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate is C=C(C)C(CCC(C)CC(=O)OCC)O[Si](C)(C)C.
What is the InChIKey of ethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate?
The InChIKey is IXGQDLWVUVOUNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O3Si/c1-8-17-15(16)11-13(4)9-10-14(12(2)3)18-19(5,6)7/h13-14H,2,8-11H2,1,3-7H3.
What are the key properties of ethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate?
ethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate has a molecular weight of 286.49 g/mol, XLogP of 4.15, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate is sourced from PubChem (CID 11208427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).