C15H30O3Si — CID 11208427
ethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate (PubChem CID 11208427) has the molecular formula C15H30O3Si and a molecular weight of 286.49 g/mol. Its IUPAC name is ethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate.
| Compound Name | ethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate |
|---|---|
| PubChem CID | 11208427 |
| Molecular Formula | C15H30O3Si |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | ethyl 3,7-dimethyl-6-trimethylsilyloxyoct-7-enoate |
| SMILES | C=C(C)C(CCC(C)CC(=O)OCC)O[Si](C)(C)C |
| InChI | InChI=1S/C15H30O3Si/c1-8-17-15(16)11-13(4)9-10-14(12(2)3)18-19(5,6)7/h13-14H,2,8-11H2,1,3-7H3 |
| InChIKey | IXGQDLWVUVOUNN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|