C21H21NO3 — CID 11209865
(1R,4R,5R,8S,9R,12S,15R,22R)-2,24-dioxa-10-azaheptacyclo[13.6.2.15,8.01,10.04,9.012,22.016,21]tetracosa-6,16,18,20-tetraen-11-one (PubChem CID 11209865) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is (1R,4R,5R,8S,9R,12S,15R,22R)-2,24-dioxa-10-azaheptacyclo[13.6.2.15,8.01,10.04,9.012,22.016,21]tetracosa-6,16,18,20-tetraen-11-one.
| Compound Name | (1R,4R,5R,8S,9R,12S,15R,22R)-2,24-dioxa-10-azaheptacyclo[13.6.2.15,8.01,10.04,9.012,22.016,21]tetracosa-6,16,18,20-tetraen-11-one |
|---|---|
| PubChem CID | 11209865 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (1R,4R,5R,8S,9R,12S,15R,22R)-2,24-dioxa-10-azaheptacyclo[13.6.2.15,8.01,10.04,9.012,22.016,21]tetracosa-6,16,18,20-tetraen-11-one |
| SMILES | O=C1[C@H]2CC[C@@H]3C[C@H]2[C@@]2(OC[C@H]4[C@H]([C@@H]5C=C[C@H]4O5)N12)c1ccccc13 |
| InChI | InChI=1S/C21H21NO3/c23-20-13-6-5-11-9-16(13)21(15-4-2-1-3-12(11)15)22(20)19-14(10-24-21)17-7-8-18(19)25-17/h1-4,7-8,11,13-14,16-19H,5-6,9-10H2/t11-,13+,14-,16-,17-,18+,19-,21+/m1/s1 |
| InChIKey | SKCOEQKWWFLTEO-DUCOMCRTSA-N |
| XLogP | 2.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|