C29H34N2O4 — CID 173468220
tert-butyl (1R,10R,14R)-12-oxo-14-phenylspiro[16-oxa-13-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-8,4'-piperidine]-1'-carboxylate (PubChem CID 173468220) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is tert-butyl (1R,10R,14R)-12-oxo-14-phenylspiro[16-oxa-13-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-8,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl (1R,10R,14R)-12-oxo-14-phenylspiro[16-oxa-13-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-8,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 173468220 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | tert-butyl (1R,10R,14R)-12-oxo-14-phenylspiro[16-oxa-13-azatetracyclo[8.6.0.01,13.02,7]hexadeca-2,4,6-triene-8,4'-piperidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C[C@@H]1CC(=O)N3[C@H](c4ccccc4)CO[C@@]13c1ccccc12 |
| InChI | InChI=1S/C29H34N2O4/c1-27(2,3)35-26(33)30-15-13-28(14-16-30)18-21-17-25(32)31-24(20-9-5-4-6-10-20)19-34-29(21,31)23-12-8-7-11-22(23)28/h4-12,21,24H,13-19H2,1-3H3/t21-,24-,29+/m0/s1 |
| InChIKey | UEYZSWACNAUTPJ-RPFOIHMYSA-N |
| XLogP | 5.13 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |