C21H27NO2 — CID 10544061
(1R,2R,4S,6S,9S,11R)-2,6,12,12-tetramethyl-4-phenyl-3-oxa-8-azatetracyclo[9.1.1.02,9.04,8]tridecan-7-one (PubChem CID 10544061) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is (1R,2R,4S,6S,9S,11R)-2,6,12,12-tetramethyl-4-phenyl-3-oxa-8-azatetracyclo[9.1.1.02,9.04,8]tridecan-7-one.
| Compound Name | (1R,2R,4S,6S,9S,11R)-2,6,12,12-tetramethyl-4-phenyl-3-oxa-8-azatetracyclo[9.1.1.02,9.04,8]tridecan-7-one |
|---|---|
| PubChem CID | 10544061 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | (1R,2R,4S,6S,9S,11R)-2,6,12,12-tetramethyl-4-phenyl-3-oxa-8-azatetracyclo[9.1.1.02,9.04,8]tridecan-7-one |
| SMILES | C[C@H]1C[C@@]2(c3ccccc3)O[C@@]3(C)[C@H](C[C@H]4C[C@@H]3C4(C)C)N2C1=O |
| InChI | InChI=1S/C21H27NO2/c1-13-12-21(14-8-6-5-7-9-14)22(18(13)23)17-11-15-10-16(19(15,2)3)20(17,4)24-21/h5-9,13,15-17H,10-12H2,1-4H3/t13-,15+,16+,17-,20+,21-/m0/s1 |
| InChIKey | VGRRFZFIMNAFAN-KESHLRAWSA-N |
| XLogP | 3.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |