C21H27NO3 — CID 10497433
(4S,5R)-5-methyl-3-phenyl-4-[(1R,2R,4S,6S,8R)-2,9,9-trimethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-4-yl]-4,5-dihydro-1,2-oxazole (PubChem CID 10497433) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is (4S,5R)-5-methyl-3-phenyl-4-[(1R,2R,4S,6S,8R)-2,9,9-trimethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-4-yl]-4,5-dihydro-1,2-oxazole.
| Compound Name | (4S,5R)-5-methyl-3-phenyl-4-[(1R,2R,4S,6S,8R)-2,9,9-trimethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-4-yl]-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 10497433 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (4S,5R)-5-methyl-3-phenyl-4-[(1R,2R,4S,6S,8R)-2,9,9-trimethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-4-yl]-4,5-dihydro-1,2-oxazole |
| SMILES | C[C@H]1ON=C(c2ccccc2)[C@@H]1[C@H]1O[C@H]2C[C@H]3C[C@H](C3(C)C)[C@@]2(C)O1 |
| InChI | InChI=1S/C21H27NO3/c1-12-17(18(22-25-12)13-8-6-5-7-9-13)19-23-16-11-14-10-15(20(14,2)3)21(16,4)24-19/h5-9,12,14-17,19H,10-11H2,1-4H3/t12-,14-,15-,16+,17-,19+,21-/m1/s1 |
| InChIKey | PQDYYTONNLVNFY-JPKZWTKPSA-N |
| XLogP | 3.99 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |