C22H30O2 — CID 101017720
(1S,2S,3R,7R,9S)-2,5,5,10,10-pentamethyl-3-(1-phenylethenyl)-4,6-dioxatricyclo[7.1.1.02,7]undecane (PubChem CID 101017720) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is (1S,2S,3R,7R,9S)-2,5,5,10,10-pentamethyl-3-(1-phenylethenyl)-4,6-dioxatricyclo[7.1.1.02,7]undecane.
| Compound Name | (1S,2S,3R,7R,9S)-2,5,5,10,10-pentamethyl-3-(1-phenylethenyl)-4,6-dioxatricyclo[7.1.1.02,7]undecane |
|---|---|
| PubChem CID | 101017720 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (1S,2S,3R,7R,9S)-2,5,5,10,10-pentamethyl-3-(1-phenylethenyl)-4,6-dioxatricyclo[7.1.1.02,7]undecane |
| SMILES | C=C(c1ccccc1)[C@H]1OC(C)(C)O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]12C |
| InChI | InChI=1S/C22H30O2/c1-14(15-10-8-7-9-11-15)19-22(6)17-12-16(20(17,2)3)13-18(22)23-21(4,5)24-19/h7-11,16-19H,1,12-13H2,2-6H3/t16-,17-,18+,19+,22-/m0/s1 |
| InChIKey | FFDLCJOEVOCHCW-JUMAPTCESA-N |
| XLogP | 5.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |