C14H20Si — CID 99771502
trimethyl-[(1R,2S)-2-(1-phenylethenyl)cyclopropyl]silane (PubChem CID 99771502) has the molecular formula C14H20Si and a molecular weight of 216.40 g/mol. Its IUPAC name is trimethyl-[(1R,2S)-2-(1-phenylethenyl)cyclopropyl]silane.
| Compound Name | trimethyl-[(1R,2S)-2-(1-phenylethenyl)cyclopropyl]silane |
|---|---|
| PubChem CID | 99771502 |
| Molecular Formula | C14H20Si |
| Molecular Weight | 216.40 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | trimethyl-[(1R,2S)-2-(1-phenylethenyl)cyclopropyl]silane |
| SMILES | C=C(c1ccccc1)[C@@H]1C[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C14H20Si/c1-11(12-8-6-5-7-9-12)13-10-14(13)15(2,3)4/h5-9,13-14H,1,10H2,2-4H3/t13-,14+/m0/s1 |
| InChIKey | JGNNHHSGKUGINI-UONOGXRCSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|