C14H16O4 — CID 177491219
1-methyl-4-(1-phenylethenyl)-2,3,8,9-tetraoxabicyclo[3.3.1]nonane (PubChem CID 177491219) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 1-methyl-4-(1-phenylethenyl)-2,3,8,9-tetraoxabicyclo[3.3.1]nonane.
| Compound Name | 1-methyl-4-(1-phenylethenyl)-2,3,8,9-tetraoxabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 177491219 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-methyl-4-(1-phenylethenyl)-2,3,8,9-tetraoxabicyclo[3.3.1]nonane |
| SMILES | C=C(c1ccccc1)C1OOC2(C)OCCC1O2 |
| InChI | InChI=1S/C14H16O4/c1-10(11-6-4-3-5-7-11)13-12-8-9-15-14(2,16-12)18-17-13/h3-7,12-13H,1,8-9H2,2H3 |
| InChIKey | NSKHALYSRGUHRC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|