C22H29NO3 — CID 10760682
(4R,5R)-3-ethyl-5-phenyl-4-[(1R,2R,4S,6S,8R)-2,9,9-trimethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-4-yl]-4,5-dihydro-1,2-oxazole (PubChem CID 10760682) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is (4R,5R)-3-ethyl-5-phenyl-4-[(1R,2R,4S,6S,8R)-2,9,9-trimethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-4-yl]-4,5-dihydro-1,2-oxazole.
| Compound Name | (4R,5R)-3-ethyl-5-phenyl-4-[(1R,2R,4S,6S,8R)-2,9,9-trimethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-4-yl]-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 10760682 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (4R,5R)-3-ethyl-5-phenyl-4-[(1R,2R,4S,6S,8R)-2,9,9-trimethyl-3,5-dioxatricyclo[6.1.1.02,6]decan-4-yl]-4,5-dihydro-1,2-oxazole |
| SMILES | CCC1=NO[C@@H](c2ccccc2)[C@@H]1[C@H]1O[C@H]2C[C@H]3C[C@H](C3(C)C)[C@@]2(C)O1 |
| InChI | InChI=1S/C22H29NO3/c1-5-15-18(19(26-23-15)13-9-7-6-8-10-13)20-24-17-12-14-11-16(21(14,2)3)22(17,4)25-20/h6-10,14,16-20H,5,11-12H2,1-4H3/t14-,16-,17+,18-,19+,20+,22-/m1/s1 |
| InChIKey | DSJPQBAPHMZPLB-KBCAXURISA-N |
| XLogP | 4.71 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |