About N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-methylbutanamide
N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-methylbutanamide (PubChem CID 11211892) has the molecular formula C23H27N5O2
and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-methylbutanamide.
Molecular Properties
| Compound Name | N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-methylbutanamide |
| PubChem CID | 11211892 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(-c2c(N)nc(N)nc2COCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H27N5O2/c1-15(2)12-20(29)26-18-10-8-17(9-11-18)21-19(27-23(25)28-22(21)24)14-30-13-16-6-4-3-5-7-16/h3-11,15H,12-14H2,1-2H3,(H,26,29)(H4,24,25,27,28) |
| InChIKey | QGKYEEPHMFVUEN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-methylbutanamide?
The IUPAC name of N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-methylbutanamide (CID 11211892) is N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-methylbutanamide.
What is the SMILES notation for N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-methylbutanamide?
The canonical SMILES for N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-methylbutanamide is CC(C)CC(=O)Nc1ccc(-c2c(N)nc(N)nc2COCc2ccccc2)cc1.
What is the InChIKey of N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-methylbutanamide?
The InChIKey is QGKYEEPHMFVUEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N5O2/c1-15(2)12-20(29)26-18-10-8-17(9-11-18)21-19(27-23(25)28-22(21)24)14-30-13-16-6-4-3-5-7-16/h3-11,15H,12-14H2,1-2H3,(H,26,29)(H4,24,25,27,28).
What are the key properties of N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-methylbutanamide?
N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-methylbutanamide has a molecular weight of 405.50 g/mol, XLogP of 4.01, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[2,4-diamino-6-(phenylmethoxymethyl)pyrimidin-5-yl]phenyl]-3-methylbutanamide is sourced from PubChem (CID 11211892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).