C16H18O3S — CID 11220005
(1S,2S,4S,5R)-2,4-dimethyl-1-[(S)-(4-methylphenyl)sulfinyl]-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 11220005) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is (1S,2S,4S,5R)-2,4-dimethyl-1-[(S)-(4-methylphenyl)sulfinyl]-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1S,2S,4S,5R)-2,4-dimethyl-1-[(S)-(4-methylphenyl)sulfinyl]-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 11220005 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (1S,2S,4S,5R)-2,4-dimethyl-1-[(S)-(4-methylphenyl)sulfinyl]-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | Cc1ccc([S@](=O)[C@]23C=C[C@@H](O2)[C@H](C)C(=O)[C@@H]3C)cc1 |
| InChI | InChI=1S/C16H18O3S/c1-10-4-6-13(7-5-10)20(18)16-9-8-14(19-16)11(2)15(17)12(16)3/h4-9,11-12,14H,1-3H3/t11-,12-,14+,16-,20-/m0/s1 |
| InChIKey | BNMBGBNLSCQLKR-IQTBRZPXSA-N |
| XLogP | 2.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|