C19H32N2O5 — CID 11222411
ethyl 2-[[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoyl]-(2-methylprop-2-enyl)amino]acetate (PubChem CID 11222411) has the molecular formula C19H32N2O5 and a molecular weight of 368.47 g/mol. Its IUPAC name is ethyl 2-[[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoyl]-(2-methylprop-2-enyl)amino]acetate.
| Compound Name | ethyl 2-[[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoyl]-(2-methylprop-2-enyl)amino]acetate |
|---|---|
| PubChem CID | 11222411 |
| Molecular Formula | C19H32N2O5 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | ethyl 2-[[(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoyl]-(2-methylprop-2-enyl)amino]acetate |
| SMILES | C=CC[C@@H](CC(=O)N(CC(=C)C)CC(=O)OCC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H32N2O5/c1-8-10-15(20-18(24)26-19(5,6)7)11-16(22)21(12-14(3)4)13-17(23)25-9-2/h8,15H,1,3,9-13H2,2,4-7H3,(H,20,24)/t15-/m0/s1 |
| InChIKey | RRBPWALRSMREPJ-HNNXBMFYSA-N |
| XLogP | 2.81 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|