C33H40N2O3 — CID 11226032
(3S)-2-[3-(3-methylbutan-2-yloxy)benzoyl]-N-(4-pentylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 11226032) has the molecular formula C33H40N2O3 and a molecular weight of 512.69 g/mol. Its IUPAC name is (3S)-2-[3-(3-methylbutan-2-yloxy)benzoyl]-N-(4-pentylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-2-[3-(3-methylbutan-2-yloxy)benzoyl]-N-(4-pentylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 11226032 |
| Molecular Formula | C33H40N2O3 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | (3S)-2-[3-(3-methylbutan-2-yloxy)benzoyl]-N-(4-pentylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CCCCCc1ccc(NC(=O)[C@@H]2Cc3ccccc3CN2C(=O)c2cccc(OC(C)C(C)C)c2)cc1 |
| InChI | InChI=1S/C33H40N2O3/c1-5-6-7-11-25-16-18-29(19-17-25)34-32(36)31-21-26-12-8-9-13-28(26)22-35(31)33(37)27-14-10-15-30(20-27)38-24(4)23(2)3/h8-10,12-20,23-24,31H,5-7,11,21-22H2,1-4H3,(H,34,36)/t24?,31-/m0/s1 |
| InChIKey | CLMMFJDTBKXGED-KEASEGHRSA-N |
| XLogP | 7.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|