C42H42N2O5 — CID 91299328
(3S)-2-[3-(4-ethoxy-3-phenoxyphenoxy)benzoyl]-N-(4-pentylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 91299328) has the molecular formula C42H42N2O5 and a molecular weight of 654.81 g/mol. Its IUPAC name is (3S)-2-[3-(4-ethoxy-3-phenoxyphenoxy)benzoyl]-N-(4-pentylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-2-[3-(4-ethoxy-3-phenoxyphenoxy)benzoyl]-N-(4-pentylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 91299328 |
| Molecular Formula | C42H42N2O5 |
| Molecular Weight | 654.81 g/mol |
| Exact Mass | 654.31 |
| IUPAC Name | (3S)-2-[3-(4-ethoxy-3-phenoxyphenoxy)benzoyl]-N-(4-pentylphenyl)-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CCCCCc1ccc(NC(=O)[C@@H]2Cc3ccccc3CN2C(=O)c2cccc(Oc3ccc(OCC)c(Oc4ccccc4)c3)c2)cc1 |
| InChI | InChI=1S/C42H42N2O5/c1-3-5-7-13-30-20-22-34(23-21-30)43-41(45)38-27-31-14-10-11-15-33(31)29-44(38)42(46)32-16-12-19-36(26-32)48-37-24-25-39(47-4-2)40(28-37)49-35-17-8-6-9-18-35/h6,8-12,14-26,28,38H,3-5,7,13,27,29H2,1-2H3,(H,43,45)/t38-/m0/s1 |
| InChIKey | AKGWEVGPEPBFHU-LHEWISCISA-N |
| XLogP | 9.61 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.81 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|