C30H44O4S2 — CID 11226380
S-tert-butyl (2S)-2-[(1S,5R,7aS)-5-hydroxy-7a-methyl-4-phenylsulfanyl-1,2,3,5,6,7-hexahydroinden-1-yl]-3-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]propanethioate (PubChem CID 11226380) has the molecular formula C30H44O4S2 and a molecular weight of 532.81 g/mol. Its IUPAC name is S-tert-butyl (2S)-2-[(1S,5R,7aS)-5-hydroxy-7a-methyl-4-phenylsulfanyl-1,2,3,5,6,7-hexahydroinden-1-yl]-3-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]propanethioate.
| Compound Name | S-tert-butyl (2S)-2-[(1S,5R,7aS)-5-hydroxy-7a-methyl-4-phenylsulfanyl-1,2,3,5,6,7-hexahydroinden-1-yl]-3-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]propanethioate |
|---|---|
| PubChem CID | 11226380 |
| Molecular Formula | C30H44O4S2 |
| Molecular Weight | 532.81 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | S-tert-butyl (2S)-2-[(1S,5R,7aS)-5-hydroxy-7a-methyl-4-phenylsulfanyl-1,2,3,5,6,7-hexahydroinden-1-yl]-3-[(4S)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]propanethioate |
| SMILES | CC1(C)O[C@@H](C[C@H](C(=O)SC(C)(C)C)[C@@H]2CCC3=C(Sc4ccccc4)[C@H](O)CC[C@]32C)C(C)(C)O1 |
| InChI | InChI=1S/C30H44O4S2/c1-27(2,3)36-26(32)20(18-24-28(4,5)34-29(6,7)33-24)21-14-15-22-25(23(31)16-17-30(21,22)8)35-19-12-10-9-11-13-19/h9-13,20-21,23-24,31H,14-18H2,1-8H3/t20-,21-,23+,24-,30-/m0/s1 |
| InChIKey | HXLYGQSKTNZLIW-BBRDPHIOSA-N |
| XLogP | 7.60 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.81 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|