C35H36N6O3 — CID 11227095
2-[(3-ethyl-19-methyl-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-7-yl)oxy]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 11227095) has the molecular formula C35H36N6O3 and a molecular weight of 588.71 g/mol. Its IUPAC name is 2-[(3-ethyl-19-methyl-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-7-yl)oxy]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[(3-ethyl-19-methyl-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-7-yl)oxy]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 11227095 |
| Molecular Formula | C35H36N6O3 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | 2-[(3-ethyl-19-methyl-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-7-yl)oxy]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | CCn1c2ccc(OCC(=O)Nc3ccc(N4CCCCC4)cc3)cc2c2c3c(c4c(c21)CCc1nn(C)cc1-4)C(=O)NC3 |
| InChI | InChI=1S/C35H36N6O3/c1-3-41-29-14-11-23(44-20-30(42)37-21-7-9-22(10-8-21)40-15-5-4-6-16-40)17-25(29)32-26-18-36-35(43)33(26)31-24(34(32)41)12-13-28-27(31)19-39(2)38-28/h7-11,14,17,19H,3-6,12-13,15-16,18,20H2,1-2H3,(H,36,43)(H,37,42) |
| InChIKey | VULAZARMDAOMHY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|