C34H35N5O3 — CID 11330463
N-(2,6-dimethylphenyl)-2-[[19-methyl-3-(2-methylpropyl)-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-7-yl]oxy]acetamide (PubChem CID 11330463) has the molecular formula C34H35N5O3 and a molecular weight of 561.69 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[[19-methyl-3-(2-methylpropyl)-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-7-yl]oxy]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[[19-methyl-3-(2-methylpropyl)-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-7-yl]oxy]acetamide |
|---|---|
| PubChem CID | 11330463 |
| Molecular Formula | C34H35N5O3 |
| Molecular Weight | 561.69 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[[19-methyl-3-(2-methylpropyl)-14-oxo-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-7-yl]oxy]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)COc1ccc2c(c1)c1c3c(c4c(c1n2CC(C)C)CCc1nn(C)cc1-4)C(=O)NC3 |
| InChI | InChI=1S/C34H35N5O3/c1-18(2)15-39-27-12-9-21(42-17-28(40)36-32-19(3)7-6-8-20(32)4)13-23(27)30-24-14-35-34(41)31(24)29-22(33(30)39)10-11-26-25(29)16-38(5)37-26/h6-9,12-13,16,18H,10-11,14-15,17H2,1-5H3,(H,35,41)(H,36,40) |
| InChIKey | XLGDDVMXOFEQKG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.69 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|