C32H39N7O2 — CID 123242558
7-[1-(ethoxyamino)ethenyl]-19-methyl-3-[3-(4-methylpiperazin-1-yl)propyl]-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-14-one (PubChem CID 123242558) has the molecular formula C32H39N7O2 and a molecular weight of 553.71 g/mol. Its IUPAC name is 7-[1-(ethoxyamino)ethenyl]-19-methyl-3-[3-(4-methylpiperazin-1-yl)propyl]-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-14-one.
| Compound Name | 7-[1-(ethoxyamino)ethenyl]-19-methyl-3-[3-(4-methylpiperazin-1-yl)propyl]-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-14-one |
|---|---|
| PubChem CID | 123242558 |
| Molecular Formula | C32H39N7O2 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | 7-[1-(ethoxyamino)ethenyl]-19-methyl-3-[3-(4-methylpiperazin-1-yl)propyl]-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-14-one |
| SMILES | C=C(NOCC)c1ccc2c(c1)c1c3c(c4c(c1n2CCCN1CCN(C)CC1)CCc1nn(C)cc1-4)C(=O)NC3 |
| InChI | InChI=1S/C32H39N7O2/c1-5-41-35-20(2)21-7-10-27-23(17-21)29-24-18-33-32(40)30(24)28-22(8-9-26-25(28)19-37(4)34-26)31(29)39(27)12-6-11-38-15-13-36(3)14-16-38/h7,10,17,19,35H,2,5-6,8-9,11-16,18H2,1,3-4H3,(H,33,40) |
| InChIKey | BJXFQJINTGMPIE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|