C31H30N6O2 — CID 46836237
1-(19-methyl-14-oxo-3-propyl-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-7-yl)-3-(4-methylphenyl)urea (PubChem CID 46836237) has the molecular formula C31H30N6O2 and a molecular weight of 518.62 g/mol. Its IUPAC name is 1-(19-methyl-14-oxo-3-propyl-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-7-yl)-3-(4-methylphenyl)urea.
| Compound Name | 1-(19-methyl-14-oxo-3-propyl-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-7-yl)-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 46836237 |
| Molecular Formula | C31H30N6O2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 1-(19-methyl-14-oxo-3-propyl-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-7-yl)-3-(4-methylphenyl)urea |
| SMILES | CCCn1c2ccc(NC(=O)Nc3ccc(C)cc3)cc2c2c3c(c4c(c21)CCc1nn(C)cc1-4)C(=O)NC3 |
| InChI | InChI=1S/C31H30N6O2/c1-4-13-37-25-12-9-19(34-31(39)33-18-7-5-17(2)6-8-18)14-21(25)27-22-15-32-30(38)28(22)26-20(29(27)37)10-11-24-23(26)16-36(3)35-24/h5-9,12,14,16H,4,10-11,13,15H2,1-3H3,(H,32,38)(H2,33,34,39) |
| InChIKey | KWGWZBHPJDFIBF-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|