C30H27ClN4O4S2 — CID 11273476
7-(3-chloro-4-methylsulfonylthiophene-2-carbonyl)-19-methyl-3-(2-methylpropyl)-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-14-one (PubChem CID 11273476) has the molecular formula C30H27ClN4O4S2 and a molecular weight of 607.16 g/mol. Its IUPAC name is 7-(3-chloro-4-methylsulfonylthiophene-2-carbonyl)-19-methyl-3-(2-methylpropyl)-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-14-one.
| Compound Name | 7-(3-chloro-4-methylsulfonylthiophene-2-carbonyl)-19-methyl-3-(2-methylpropyl)-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-14-one |
|---|---|
| PubChem CID | 11273476 |
| Molecular Formula | C30H27ClN4O4S2 |
| Molecular Weight | 607.16 g/mol |
| Exact Mass | 606.12 |
| IUPAC Name | 7-(3-chloro-4-methylsulfonylthiophene-2-carbonyl)-19-methyl-3-(2-methylpropyl)-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17,20-octaen-14-one |
| SMILES | CC(C)Cn1c2ccc(C(=O)c3scc(S(C)(=O)=O)c3Cl)cc2c2c3c(c4c(c21)CCc1nn(C)cc1-4)C(=O)NC3 |
| InChI | InChI=1S/C30H27ClN4O4S2/c1-14(2)11-35-21-8-5-15(28(36)29-26(31)22(13-40-29)41(4,38)39)9-17(21)24-18-10-32-30(37)25(18)23-16(27(24)35)6-7-20-19(23)12-34(3)33-20/h5,8-9,12-14H,6-7,10-11H2,1-4H3,(H,32,37) |
| InChIKey | BLBLTBKQNDEUBP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.16 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|