C27H28N6O3 — CID 143073607
3-ethyl-7-(2-oxo-2-piperazin-1-ylethoxy)-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),18-octaen-14-one (PubChem CID 143073607) has the molecular formula C27H28N6O3 and a molecular weight of 484.56 g/mol. Its IUPAC name is 3-ethyl-7-(2-oxo-2-piperazin-1-ylethoxy)-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),18-octaen-14-one.
| Compound Name | 3-ethyl-7-(2-oxo-2-piperazin-1-ylethoxy)-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),18-octaen-14-one |
|---|---|
| PubChem CID | 143073607 |
| Molecular Formula | C27H28N6O3 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 3-ethyl-7-(2-oxo-2-piperazin-1-ylethoxy)-3,13,19,20-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,21]tricosa-1(16),2(10),4(9),5,7,11(15),17(21),18-octaen-14-one |
| SMILES | CCn1c2ccc(OCC(=O)N3CCNCC3)cc2c2c3c(c4c(c21)CCc1[nH]ncc1-4)C(=O)NC3 |
| InChI | InChI=1S/C27H28N6O3/c1-2-33-21-6-3-15(36-14-22(34)32-9-7-28-8-10-32)11-17(21)24-19-12-29-27(35)25(19)23-16(26(24)33)4-5-20-18(23)13-30-31-20/h3,6,11,13,28H,2,4-5,7-10,12,14H2,1H3,(H,29,35)(H,30,31) |
| InChIKey | ATXTVULYNUPMFV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|