C19H23I3N2O6 — CID 11228016
3-acetamido-5-[acetyl-(6-ethoxy-6-oxohexyl)amino]-2,4,6-triiodobenzoic acid (PubChem CID 11228016) has the molecular formula C19H23I3N2O6 and a molecular weight of 756.11 g/mol. Its IUPAC name is 3-acetamido-5-[acetyl-(6-ethoxy-6-oxohexyl)amino]-2,4,6-triiodobenzoic acid.
| Compound Name | 3-acetamido-5-[acetyl-(6-ethoxy-6-oxohexyl)amino]-2,4,6-triiodobenzoic acid |
|---|---|
| PubChem CID | 11228016 |
| Molecular Formula | C19H23I3N2O6 |
| Molecular Weight | 756.11 g/mol |
| Exact Mass | 755.87 |
| IUPAC Name | 3-acetamido-5-[acetyl-(6-ethoxy-6-oxohexyl)amino]-2,4,6-triiodobenzoic acid |
| SMILES | CCOC(=O)CCCCCN(C(C)=O)c1c(I)c(NC(C)=O)c(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C19H23I3N2O6/c1-4-30-12(27)8-6-5-7-9-24(11(3)26)18-15(21)13(19(28)29)14(20)17(16(18)22)23-10(2)25/h4-9H2,1-3H3,(H,23,25)(H,28,29) |
| InChIKey | JTBIMQXVEHDZOR-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.11 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|