C12H14OS2 — CID 11230160
2-(4-prop-2-enoxyphenyl)-1,3-dithiolane (PubChem CID 11230160) has the molecular formula C12H14OS2 and a molecular weight of 238.38 g/mol. Its IUPAC name is 2-(4-prop-2-enoxyphenyl)-1,3-dithiolane.
| Compound Name | 2-(4-prop-2-enoxyphenyl)-1,3-dithiolane |
|---|---|
| PubChem CID | 11230160 |
| Molecular Formula | C12H14OS2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2-(4-prop-2-enoxyphenyl)-1,3-dithiolane |
| SMILES | C=CCOc1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C12H14OS2/c1-2-7-13-11-5-3-10(4-6-11)12-14-8-9-15-12/h2-6,12H,1,7-9H2 |
| InChIKey | GKMRLIKJOZIPHS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|