C12H13F3N2O2 — CID 11231137
1-(1,3-dimethylpyrazol-4-yl)-2-[2-(trifluoromethyl)-1-oxaspiro[2.2]pentan-2-yl]ethanone (PubChem CID 11231137) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)-2-[2-(trifluoromethyl)-1-oxaspiro[2.2]pentan-2-yl]ethanone.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)-2-[2-(trifluoromethyl)-1-oxaspiro[2.2]pentan-2-yl]ethanone |
|---|---|
| PubChem CID | 11231137 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)-2-[2-(trifluoromethyl)-1-oxaspiro[2.2]pentan-2-yl]ethanone |
| SMILES | Cc1nn(C)cc1C(=O)CC1(C(F)(F)F)OC12CC2 |
| InChI | InChI=1S/C12H13F3N2O2/c1-7-8(6-17(2)16-7)9(18)5-11(12(13,14)15)10(19-11)3-4-10/h6H,3-5H2,1-2H3 |
| InChIKey | TYMGXJVDHJYFEH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 47.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|