C17H26NP — CID 11231184
3,5-ditert-butyl-N,N-dimethyl-4-(phosphanylidynemethyl)aniline (PubChem CID 11231184) has the molecular formula C17H26NP and a molecular weight of 275.38 g/mol. Its IUPAC name is 3,5-ditert-butyl-N,N-dimethyl-4-(phosphanylidynemethyl)aniline.
| Compound Name | 3,5-ditert-butyl-N,N-dimethyl-4-(phosphanylidynemethyl)aniline |
|---|---|
| PubChem CID | 11231184 |
| Molecular Formula | C17H26NP |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | 3,5-ditert-butyl-N,N-dimethyl-4-(phosphanylidynemethyl)aniline |
| SMILES | CN(C)c1cc(C(C)(C)C)c(C#P)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H26NP/c1-16(2,3)14-9-12(18(7)8)10-15(13(14)11-19)17(4,5)6/h9-10H,1-8H3 |
| InChIKey | KDRMLPYNMZNSQW-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|