C17H11ClN2O2 — CID 11232161
1-[8-chloro-2-(3-methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]prop-2-yn-1-one (PubChem CID 11232161) has the molecular formula C17H11ClN2O2 and a molecular weight of 310.74 g/mol. Its IUPAC name is 1-[8-chloro-2-(3-methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]prop-2-yn-1-one.
| Compound Name | 1-[8-chloro-2-(3-methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 11232161 |
| Molecular Formula | C17H11ClN2O2 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 1-[8-chloro-2-(3-methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]prop-2-yn-1-one |
| SMILES | C#CC(=O)c1c(-c2cccc(OC)c2)nc2c(Cl)cccn12 |
| InChI | InChI=1S/C17H11ClN2O2/c1-3-14(21)16-15(11-6-4-7-12(10-11)22-2)19-17-13(18)8-5-9-20(16)17/h1,4-10H,2H3 |
| InChIKey | FCVAIGOUJICJIM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|