C14H23NO5Si — CID 11232244
dimethyl (2S,3S,4S)-1-acetyl-4-trimethylsilyl-3,4-dihydro-2H-pyridine-2,3-dicarboxylate (PubChem CID 11232244) has the molecular formula C14H23NO5Si and a molecular weight of 313.43 g/mol. Its IUPAC name is dimethyl (2S,3S,4S)-1-acetyl-4-trimethylsilyl-3,4-dihydro-2H-pyridine-2,3-dicarboxylate.
| Compound Name | dimethyl (2S,3S,4S)-1-acetyl-4-trimethylsilyl-3,4-dihydro-2H-pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11232244 |
| Molecular Formula | C14H23NO5Si |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | dimethyl (2S,3S,4S)-1-acetyl-4-trimethylsilyl-3,4-dihydro-2H-pyridine-2,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C(=O)OC)N(C(C)=O)C=C[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C14H23NO5Si/c1-9(16)15-8-7-10(21(4,5)6)11(13(17)19-2)12(15)14(18)20-3/h7-8,10-12H,1-6H3/t10-,11-,12-/m0/s1 |
| InChIKey | SKGVBVPDIJFQJW-SRVKXCTJSA-N |
| XLogP | 1.40 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|