C20H40O2Si — CID 11233116
(4R,6S)-2,5,5-trimethyl-6-tri(propan-2-yl)silyloxyoct-7-yn-4-ol (PubChem CID 11233116) has the molecular formula C20H40O2Si and a molecular weight of 340.62 g/mol. Its IUPAC name is (4R,6S)-2,5,5-trimethyl-6-tri(propan-2-yl)silyloxyoct-7-yn-4-ol.
| Compound Name | (4R,6S)-2,5,5-trimethyl-6-tri(propan-2-yl)silyloxyoct-7-yn-4-ol |
|---|---|
| PubChem CID | 11233116 |
| Molecular Formula | C20H40O2Si |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | (4R,6S)-2,5,5-trimethyl-6-tri(propan-2-yl)silyloxyoct-7-yn-4-ol |
| SMILES | C#C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)C(C)(C)[C@H](O)CC(C)C |
| InChI | InChI=1S/C20H40O2Si/c1-12-19(20(10,11)18(21)13-14(2)3)22-23(15(4)5,16(6)7)17(8)9/h1,14-19,21H,13H2,2-11H3/t18-,19+/m1/s1 |
| InChIKey | CSOIJXGKSBKTEI-MOPGFXCFSA-N |
| XLogP | 5.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|