C20H40O3Si — CID 11233615
tert-butyl-[(2S,3R)-1-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]-3-methylhex-5-en-2-yl]oxy-dimethylsilane (PubChem CID 11233615) has the molecular formula C20H40O3Si and a molecular weight of 356.62 g/mol. Its IUPAC name is tert-butyl-[(2S,3R)-1-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]-3-methylhex-5-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3R)-1-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]-3-methylhex-5-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11233615 |
| Molecular Formula | C20H40O3Si |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | tert-butyl-[(2S,3R)-1-[(4R)-2,2-diethyl-1,3-dioxolan-4-yl]-3-methylhex-5-en-2-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@@H](C)[C@H](C[C@@H]1COC(CC)(CC)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O3Si/c1-10-13-16(4)18(23-24(8,9)19(5,6)7)14-17-15-21-20(11-2,12-3)22-17/h10,16-18H,1,11-15H2,2-9H3/t16-,17-,18+/m1/s1 |
| InChIKey | SWHZQRAHVLUYRC-KURKYZTESA-N |
| XLogP | 5.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|