C21H38Br2O4Si — CID 11071617
tert-butyl-[(1R,2S,3R)-6,6-dibromo-3-ethenyl-2-methoxy-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hex-5-enoxy]-dimethylsilane (PubChem CID 11071617) has the molecular formula C21H38Br2O4Si and a molecular weight of 542.43 g/mol. Its IUPAC name is tert-butyl-[(1R,2S,3R)-6,6-dibromo-3-ethenyl-2-methoxy-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hex-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2S,3R)-6,6-dibromo-3-ethenyl-2-methoxy-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hex-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11071617 |
| Molecular Formula | C21H38Br2O4Si |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | tert-butyl-[(1R,2S,3R)-6,6-dibromo-3-ethenyl-2-methoxy-1-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]hex-5-enoxy]-dimethylsilane |
| SMILES | C=C[C@@H](CC=C(Br)Br)[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1C |
| InChI | InChI=1S/C21H38Br2O4Si/c1-11-15(12-13-16(22)23)18(24-8)19(27-28(9,10)20(3,4)5)17-14(2)25-21(6,7)26-17/h11,13-15,17-19H,1,12H2,2-10H3/t14-,15+,17+,18+,19+/m1/s1 |
| InChIKey | MHGHTOBUFZAPIQ-UYKLPWQDSA-N |
| XLogP | 6.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|