C21H40Br2O5Si — CID 11146121
(3R)-6,6-dibromo-3-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethyl]hex-5-en-1-ol (PubChem CID 11146121) has the molecular formula C21H40Br2O5Si and a molecular weight of 560.44 g/mol. Its IUPAC name is (3R)-6,6-dibromo-3-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethyl]hex-5-en-1-ol.
| Compound Name | (3R)-6,6-dibromo-3-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethyl]hex-5-en-1-ol |
|---|---|
| PubChem CID | 11146121 |
| Molecular Formula | C21H40Br2O5Si |
| Molecular Weight | 560.44 g/mol |
| Exact Mass | 558.10 |
| IUPAC Name | (3R)-6,6-dibromo-3-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethyl]hex-5-en-1-ol |
| SMILES | CO[C@@H]([C@H](CC=C(Br)Br)CCO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1C |
| InChI | InChI=1S/C21H40Br2O5Si/c1-14-17(27-21(5,6)26-14)19(28-29(8,9)20(2,3)4)18(25-7)15(12-13-24)10-11-16(22)23/h11,14-15,17-19,24H,10,12-13H2,1-9H3/t14-,15-,17+,18+,19+/m1/s1 |
| InChIKey | YIKRMXMDKOMZTC-PTGCCPEKSA-N |
| XLogP | 5.95 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.44 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|