C19H38O4Si — CID 59071257
(2R,3S)-2-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhex-5-en-3-ol (PubChem CID 59071257) has the molecular formula C19H38O4Si and a molecular weight of 358.60 g/mol. Its IUPAC name is (2R,3S)-2-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhex-5-en-3-ol.
| Compound Name | (2R,3S)-2-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhex-5-en-3-ol |
|---|---|
| PubChem CID | 59071257 |
| Molecular Formula | C19H38O4Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (2R,3S)-2-[(4R,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhex-5-en-3-ol |
| SMILES | C=CC[C@](C)(O)[C@H](C)[C@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O4Si/c1-11-12-19(8,20)14(2)16-15(22-18(6,7)23-16)13-21-24(9,10)17(3,4)5/h11,14-16,20H,1,12-13H2,2-10H3/t14-,15+,16-,19+/m1/s1 |
| InChIKey | IJHOTYMCWFGQPD-OLMMMNRUSA-N |
| XLogP | 4.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|