C20H22O7 — CID 11234178
[(3S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dioxo-3-[(1R)-1-phenylprop-2-enyl]oxolan-3-yl] acetate (PubChem CID 11234178) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is [(3S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dioxo-3-[(1R)-1-phenylprop-2-enyl]oxolan-3-yl] acetate.
| Compound Name | [(3S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dioxo-3-[(1R)-1-phenylprop-2-enyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 11234178 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | [(3S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,4-dioxo-3-[(1R)-1-phenylprop-2-enyl]oxolan-3-yl] acetate |
| SMILES | C=C[C@H](c1ccccc1)[C@@]1(OC(C)=O)C(=O)O[C@H]([C@@H]2COC(C)(C)O2)C1=O |
| InChI | InChI=1S/C20H22O7/c1-5-14(13-9-7-6-8-10-13)20(26-12(2)21)17(22)16(25-18(20)23)15-11-24-19(3,4)27-15/h5-10,14-16H,1,11H2,2-4H3/t14-,15+,16-,20+/m1/s1 |
| InChIKey | AXIUNHDBMQMCHI-ASKKUZCQSA-N |
| XLogP | 1.90 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|