C18H20O6 — CID 10404497
(5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-3-[(E)-3-phenylprop-2-enyl]oxolane-2,4-dione (PubChem CID 10404497) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is (5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-3-[(E)-3-phenylprop-2-enyl]oxolane-2,4-dione.
| Compound Name | (5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-3-[(E)-3-phenylprop-2-enyl]oxolane-2,4-dione |
|---|---|
| PubChem CID | 10404497 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-3-[(E)-3-phenylprop-2-enyl]oxolane-2,4-dione |
| SMILES | CC1(C)OC[C@@H]([C@H]2OC(=O)C(O)(C/C=C/c3ccccc3)C2=O)O1 |
| InChI | InChI=1S/C18H20O6/c1-17(2)22-11-13(24-17)14-15(19)18(21,16(20)23-14)10-6-9-12-7-4-3-5-8-12/h3-9,13-14,21H,10-11H2,1-2H3/b9-6+/t13-,14+,18?/m0/s1 |
| InChIKey | LEJQKOOONKXINJ-DODOXWLOSA-N |
| XLogP | 1.47 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|