C23H18O4 — CID 10498597
1,8,10-trihydroxy-10-[(E)-3-phenylprop-2-enyl]anthracen-9-one (PubChem CID 10498597) has the molecular formula C23H18O4 and a molecular weight of 358.39 g/mol. Its IUPAC name is 1,8,10-trihydroxy-10-[(E)-3-phenylprop-2-enyl]anthracen-9-one.
| Compound Name | 1,8,10-trihydroxy-10-[(E)-3-phenylprop-2-enyl]anthracen-9-one |
|---|---|
| PubChem CID | 10498597 |
| Molecular Formula | C23H18O4 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 1,8,10-trihydroxy-10-[(E)-3-phenylprop-2-enyl]anthracen-9-one |
| SMILES | O=C1c2c(O)cccc2C(O)(C/C=C/c2ccccc2)c2cccc(O)c21 |
| InChI | InChI=1S/C23H18O4/c24-18-12-4-10-16-20(18)22(26)21-17(11-5-13-19(21)25)23(16,27)14-6-9-15-7-2-1-3-8-15/h1-13,24-25,27H,14H2/b9-6+ |
| InChIKey | HDPIAWJNIQUJQW-RMKNXTFCSA-N |
| XLogP | 3.98 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |