C25H22O — CID 101442795
(1S,3E)-3-benzylidene-1-[(E)-3-phenylprop-2-enyl]-2H-inden-1-ol (PubChem CID 101442795) has the molecular formula C25H22O and a molecular weight of 338.45 g/mol. Its IUPAC name is (1S,3E)-3-benzylidene-1-[(E)-3-phenylprop-2-enyl]-2H-inden-1-ol.
| Compound Name | (1S,3E)-3-benzylidene-1-[(E)-3-phenylprop-2-enyl]-2H-inden-1-ol |
|---|---|
| PubChem CID | 101442795 |
| Molecular Formula | C25H22O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (1S,3E)-3-benzylidene-1-[(E)-3-phenylprop-2-enyl]-2H-inden-1-ol |
| SMILES | O[C@@]1(C/C=C/c2ccccc2)C/C(=C\c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H22O/c26-25(17-9-14-20-10-3-1-4-11-20)19-22(18-21-12-5-2-6-13-21)23-15-7-8-16-24(23)25/h1-16,18,26H,17,19H2/b14-9+,22-18+/t25-/m0/s1 |
| InChIKey | AHTFYCPTHQLOGQ-MAJLTXJCSA-N |
| XLogP | 5.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|